![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| --Degree Programmes.php | 2020-07-25 11:33 | 26K | |
| Academic Programmes.php | 2018-05-02 10:55 | 5.9K | |
| Background.php | 2018-05-02 10:55 | 4.6K | |
| Dissertation.php | 2018-05-02 10:55 | 4.8K | |
| Examination.php | 2018-05-02 10:55 | 4.3K | |
| Fee Structure.php | 2018-05-02 10:55 | 16K | |
| General Entry Requir..> | 2018-05-02 10:55 | 16K | |
| Master Programmes.php | 2021-08-24 21:44 | 7.6K | |
| Master of Applied Ec..> | 2020-08-11 09:01 | 7.7K | |
| Master of Arts.php | 2020-12-02 05:34 | 11K | |
| Master of Developmen..> | 2020-08-11 09:01 | 7.3K | |
| Master of Education.php | 2021-08-24 21:46 | 8.0K | |
| Master of Science in..> | 2020-08-11 08:49 | 58K | |
| Master of Science in..> | 2020-07-25 15:13 | 7.4K | |
| PGDip.php | 2020-07-25 15:18 | 5.5K | |
| PGDip Education .php | 2021-08-24 21:42 | 4.8K | |
| PGDip Other Discipli..> | 2021-08-24 21:42 | 5.2K | |
| PGDip Physical Educa..> | 2021-08-24 21:42 | 5.0K | |
| Programmes-Doctor of..> | 2020-07-25 15:21 | 6.1K | |
| Programmes-Master of..> | 2020-07-25 15:21 | 6.4K | |
| Qualification Requir..> | 2018-05-02 10:55 | 10K | |
| Research.php | 2018-05-02 10:55 | 4.8K | |
| Short courses.php | 2018-05-02 10:55 | 5.6K | |
| Summer Program.php | 2018-05-02 10:55 | 11K | |
| Sustainable Tourism ..> | 2019-07-17 05:54 | 71K | |
| courses.php | 2018-05-02 10:55 | 4.6K | |